C27H28ClN3O6 — CID 4522719
N'-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide (PubChem CID 4522719) has the molecular formula C27H28ClN3O6 and a molecular weight of 525.99 g/mol. Its IUPAC name is N'-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide.
| Compound Name | N'-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 4522719 |
| Molecular Formula | C27H28ClN3O6 |
| Molecular Weight | 525.99 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | N'-[[3-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methoxyphenyl]methylideneamino]-N-(2,4-dimethoxyphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NN=Cc2ccc(OC)c(COc3cc(C)c(Cl)c(C)c3)c2)c(OC)c1 |
| InChI | InChI=1S/C27H28ClN3O6/c1-16-10-21(11-17(2)25(16)28)37-15-19-12-18(6-9-23(19)35-4)14-29-31-27(33)26(32)30-22-8-7-20(34-3)13-24(22)36-5/h6-14H,15H2,1-5H3,(H,30,32)(H,31,33) |
| InChIKey | SQCJDJKMOWSWQN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.99 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|