C28H25N3O5 — CID 19660577
N-(2,4-dimethoxyphenyl)-N'-[(E)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide (PubChem CID 19660577) has the molecular formula C28H25N3O5 and a molecular weight of 483.52 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-N'-[(E)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-N'-[(E)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 19660577 |
| Molecular Formula | C28H25N3O5 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-N'-[(E)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)N/N=C/c2ccc(OCc3cccc4ccccc34)cc2)c(OC)c1 |
| InChI | InChI=1S/C28H25N3O5/c1-34-23-14-15-25(26(16-23)35-2)30-27(32)28(33)31-29-17-19-10-12-22(13-11-19)36-18-21-8-5-7-20-6-3-4-9-24(20)21/h3-17H,18H2,1-2H3,(H,30,32)(H,31,33)/b29-17+ |
| InChIKey | VYSYLHLSPDQEJA-STBIYBPSSA-N |
| XLogP | 4.52 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|