C30H29N3O5 — CID 4088877
N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide (PubChem CID 4088877) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide.
| Compound Name | N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 4088877 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | N'-[[3-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NN=Cc2ccc(OCc3cccc4ccccc34)c(OCC)c2)cc1 |
| InChI | InChI=1S/C30H29N3O5/c1-3-36-25-15-13-24(14-16-25)32-29(34)30(35)33-31-19-21-12-17-27(28(18-21)37-4-2)38-20-23-10-7-9-22-8-5-6-11-26(22)23/h5-19H,3-4,20H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | OFZDSNSSNHJSJP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|