C25H24ClN3O5 — CID 4094540
N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide (PubChem CID 4094540) has the molecular formula C25H24ClN3O5 and a molecular weight of 481.94 g/mol. Its IUPAC name is N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide.
| Compound Name | N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 4094540 |
| Molecular Formula | C25H24ClN3O5 |
| Molecular Weight | 481.94 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(4-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NN=Cc2ccc(OCc3ccccc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C25H24ClN3O5/c1-3-33-20-11-9-19(10-12-20)28-24(30)25(31)29-27-15-17-8-13-22(23(14-17)32-2)34-16-18-6-4-5-7-21(18)26/h4-15H,3,16H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | PUFDTGJNLRAYJM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.94 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|