C23H18Cl3N3O4 — CID 3611008
N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide (PubChem CID 3611008) has the molecular formula C23H18Cl3N3O4 and a molecular weight of 506.77 g/mol. Its IUPAC name is N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide.
| Compound Name | N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 3611008 |
| Molecular Formula | C23H18Cl3N3O4 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | N'-[[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(3,5-dichlorophenyl)oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2cc(Cl)cc(Cl)c2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H18Cl3N3O4/c1-32-21-8-14(6-7-20(21)33-13-15-4-2-3-5-19(15)26)12-27-29-23(31)22(30)28-18-10-16(24)9-17(25)11-18/h2-12H,13H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | VUEYYVBKSWLQMX-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|