C24H18Cl2F3N3O4 — CID 3523972
N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide (PubChem CID 3523972) has the molecular formula C24H18Cl2F3N3O4 and a molecular weight of 540.33 g/mol. Its IUPAC name is N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 3523972 |
| Molecular Formula | C24H18Cl2F3N3O4 |
| Molecular Weight | 540.33 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-[4-(trifluoromethyl)phenyl]oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2ccc(C(F)(F)F)cc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H18Cl2F3N3O4/c1-35-21-10-14(2-9-20(21)36-13-15-3-6-17(25)11-19(15)26)12-30-32-23(34)22(33)31-18-7-4-16(5-8-18)24(27,28)29/h2-12H,13H2,1H3,(H,31,33)(H,32,34) |
| InChIKey | PHYSAHPTNJKWFF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.33 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|