C24H17Cl3F3N3O4 — CID 5203733
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide (PubChem CID 5203733) has the molecular formula C24H17Cl3F3N3O4 and a molecular weight of 574.77 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 5203733 |
| Molecular Formula | C24H17Cl3F3N3O4 |
| Molecular Weight | 574.77 g/mol |
| Exact Mass | 573.02 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]oxamide |
| SMILES | COc1cc(C=NNC(=O)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H17Cl3F3N3O4/c1-36-21-8-13(2-7-20(21)37-12-14-3-5-16(25)10-18(14)27)11-31-33-23(35)22(34)32-19-9-15(24(28,29)30)4-6-17(19)26/h2-11H,12H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | FMHDWCNHOULQGJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.77 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|