C22H15Cl4N3O3 — CID 19658498
N-(2,5-dichlorophenyl)-N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 19658498) has the molecular formula C22H15Cl4N3O3 and a molecular weight of 511.19 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,5-dichlorophenyl)-N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 19658498 |
| Molecular Formula | C22H15Cl4N3O3 |
| Molecular Weight | 511.19 g/mol |
| Exact Mass | 508.99 |
| IUPAC Name | N-(2,5-dichlorophenyl)-N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccc(Cl)cc2Cl)cc1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H15Cl4N3O3/c23-15-4-3-14(19(26)9-15)12-32-17-6-1-13(2-7-17)11-27-29-22(31)21(30)28-20-10-16(24)5-8-18(20)25/h1-11H,12H2,(H,28,30)(H,29,31)/b27-11+ |
| InChIKey | ZJUWKLLVZUZXDA-LUOAPIJWSA-N |
| XLogP | 5.97 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.19 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|