C17H13ClF3N3O3 — CID 4166909
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(3-methoxyphenyl)methylideneamino]oxamide (PubChem CID 4166909) has the molecular formula C17H13ClF3N3O3 and a molecular weight of 399.76 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(3-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(3-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 4166909 |
| Molecular Formula | C17H13ClF3N3O3 |
| Molecular Weight | 399.76 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(3-methoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1cccc(C=NNC(=O)C(=O)Nc2cc(C(F)(F)F)ccc2Cl)c1 |
| InChI | InChI=1S/C17H13ClF3N3O3/c1-27-12-4-2-3-10(7-12)9-22-24-16(26)15(25)23-14-8-11(17(19,20)21)5-6-13(14)18/h2-9H,1H3,(H,23,25)(H,24,26) |
| InChIKey | VOBCMBLWVRBDKC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|