C21H13ClF3N3O4S — CID 3650298
[3-[[[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate (PubChem CID 3650298) has the molecular formula C21H13ClF3N3O4S and a molecular weight of 495.87 g/mol. Its IUPAC name is [3-[[[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [3-[[[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3650298 |
| Molecular Formula | C21H13ClF3N3O4S |
| Molecular Weight | 495.87 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | [3-[[[2-[2-chloro-5-(trifluoromethyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] thiophene-2-carboxylate |
| SMILES | O=C(NN=Cc1cccc(OC(=O)c2cccs2)c1)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C21H13ClF3N3O4S/c22-15-7-6-13(21(23,24)25)10-16(15)27-18(29)19(30)28-26-11-12-3-1-4-14(9-12)32-20(31)17-5-2-8-33-17/h1-11H,(H,27,29)(H,28,30) |
| InChIKey | ZNBBNCHZIVJWDZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.87 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|