C23H17Cl2N3O4 — CID 19659836
[3-[(E)-[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate (PubChem CID 19659836) has the molecular formula C23H17Cl2N3O4 and a molecular weight of 470.31 g/mol. Its IUPAC name is [3-[(E)-[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate.
| Compound Name | [3-[(E)-[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 19659836 |
| Molecular Formula | C23H17Cl2N3O4 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.06 |
| IUPAC Name | [3-[(E)-[[2-(2,3-dichloroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cccc(/C=N/NC(=O)C(=O)Nc3cccc(Cl)c3Cl)c2)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O4/c1-14-8-10-16(11-9-14)23(31)32-17-5-2-4-15(12-17)13-26-28-22(30)21(29)27-19-7-3-6-18(24)20(19)25/h2-13H,1H3,(H,27,29)(H,28,30)/b26-13+ |
| InChIKey | VQGXGYXWNZNHLA-LGJNPRDNSA-N |
| XLogP | 4.61 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|