C16H15N3O2S — CID 5426343
[3-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 4-methylbenzoate (PubChem CID 5426343) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is [3-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 4-methylbenzoate.
| Compound Name | [3-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 5426343 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [3-[(Z)-(carbamothioylhydrazinylidene)methyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2cccc(/C=N\NC(N)=S)c2)cc1 |
| InChI | InChI=1S/C16H15N3O2S/c1-11-5-7-13(8-6-11)15(20)21-14-4-2-3-12(9-14)10-18-19-16(17)22/h2-10H,1H3,(H3,17,19,22)/b18-10- |
| InChIKey | YOOWMYMKJSPEPK-ZDLGFXPLSA-N |
| XLogP | 2.38 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|