C21H20Cl2N4O4 — CID 126262790
N-(2,3-dichlorophenyl)-N'-[(Z)-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide (PubChem CID 126262790) has the molecular formula C21H20Cl2N4O4 and a molecular weight of 463.32 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[(Z)-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[(Z)-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 126262790 |
| Molecular Formula | C21H20Cl2N4O4 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[(Z)-[3-(2-oxo-2-pyrrolidin-1-ylethoxy)phenyl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C\c1cccc(OCC(=O)N2CCCC2)c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H20Cl2N4O4/c22-16-7-4-8-17(19(16)23)25-20(29)21(30)26-24-12-14-5-3-6-15(11-14)31-13-18(28)27-9-1-2-10-27/h3-8,11-12H,1-2,9-10,13H2,(H,25,29)(H,26,30)/b24-12- |
| InChIKey | MJSHNHCMYBBEFY-MSXFZWOLSA-N |
| XLogP | 3.08 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|