C26H18ClN3O4 — CID 5011685
[3-[[[2-(naphthalen-1-ylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate (PubChem CID 5011685) has the molecular formula C26H18ClN3O4 and a molecular weight of 471.90 g/mol. Its IUPAC name is [3-[[[2-(naphthalen-1-ylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [3-[[[2-(naphthalen-1-ylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 5011685 |
| Molecular Formula | C26H18ClN3O4 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | [3-[[[2-(naphthalen-1-ylamino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| SMILES | O=C(NN=Cc1cccc(OC(=O)c2ccc(Cl)cc2)c1)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C26H18ClN3O4/c27-20-13-11-19(12-14-20)26(33)34-21-8-3-5-17(15-21)16-28-30-25(32)24(31)29-23-10-4-7-18-6-1-2-9-22(18)23/h1-16H,(H,29,31)(H,30,32) |
| InChIKey | SYAWQBIXZBXPMA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|