C23H15ClF3N3O4 — CID 19658254
[3-[(E)-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate (PubChem CID 19658254) has the molecular formula C23H15ClF3N3O4 and a molecular weight of 489.84 g/mol. Its IUPAC name is [3-[(E)-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate.
| Compound Name | [3-[(E)-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 19658254 |
| Molecular Formula | C23H15ClF3N3O4 |
| Molecular Weight | 489.84 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | [3-[(E)-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenyl] 3-chlorobenzoate |
| SMILES | O=C(N/N=C/c1cccc(OC(=O)c2cccc(Cl)c2)c1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H15ClF3N3O4/c24-17-5-2-4-15(12-17)22(33)34-19-6-1-3-14(11-19)13-28-30-21(32)20(31)29-18-9-7-16(8-10-18)23(25,26)27/h1-13H,(H,29,31)(H,30,32)/b28-13+ |
| InChIKey | KWCGNUYSDFVFCB-XODNFHPESA-N |
| XLogP | 4.67 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.84 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|