C16H9Cl3F3N3O2 — CID 5086061
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(2,4-dichlorophenyl)methylideneamino]oxamide (PubChem CID 5086061) has the molecular formula C16H9Cl3F3N3O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(2,4-dichlorophenyl)methylideneamino]oxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(2,4-dichlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 5086061 |
| Molecular Formula | C16H9Cl3F3N3O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[(2,4-dichlorophenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1Cl)C(=O)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H9Cl3F3N3O2/c17-10-3-1-8(12(19)6-10)7-23-25-15(27)14(26)24-13-5-9(16(20,21)22)2-4-11(13)18/h1-7H,(H,24,26)(H,25,27) |
| InChIKey | SULRHGLFOZWABS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|