C15H9Cl4N3O2 — CID 3336586
N-(2,5-dichlorophenyl)-N'-[(2,3-dichlorophenyl)methylideneamino]oxamide (PubChem CID 3336586) has the molecular formula C15H9Cl4N3O2 and a molecular weight of 405.07 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-N'-[(2,3-dichlorophenyl)methylideneamino]oxamide.
| Compound Name | N-(2,5-dichlorophenyl)-N'-[(2,3-dichlorophenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 3336586 |
| Molecular Formula | C15H9Cl4N3O2 |
| Molecular Weight | 405.07 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | N-(2,5-dichlorophenyl)-N'-[(2,3-dichlorophenyl)methylideneamino]oxamide |
| SMILES | O=C(NN=Cc1cccc(Cl)c1Cl)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H9Cl4N3O2/c16-9-4-5-10(17)12(6-9)21-14(23)15(24)22-20-7-8-2-1-3-11(18)13(8)19/h1-7H,(H,21,23)(H,22,24) |
| InChIKey | CKQXNPBCIDJBNQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.07 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|