C16H13Cl2N3O4 — CID 136611999
N-(2,5-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]oxamide (PubChem CID 136611999) has the molecular formula C16H13Cl2N3O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]oxamide.
| Compound Name | N-(2,5-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]oxamide |
|---|---|
| PubChem CID | 136611999 |
| Molecular Formula | C16H13Cl2N3O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-N'-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]oxamide |
| SMILES | COc1ccc(O)c(/C=N/NC(=O)C(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N3O4/c1-25-11-3-5-14(22)9(6-11)8-19-21-16(24)15(23)20-13-7-10(17)2-4-12(13)18/h2-8,22H,1H3,(H,20,23)(H,21,24)/b19-8+ |
| InChIKey | YPKQBBPTFCBEOL-UFWORHAWSA-N |
| XLogP | 2.80 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|