C15H14ClN3O2S — CID 136683555
1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)thiourea (PubChem CID 136683555) has the molecular formula C15H14ClN3O2S and a molecular weight of 335.82 g/mol. Its IUPAC name is 1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 136683555 |
| Molecular Formula | C15H14ClN3O2S |
| Molecular Weight | 335.82 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[(Z)-(5-chloro-2-hydroxyphenyl)methylideneamino]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C\c2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C15H14ClN3O2S/c1-21-13-5-3-12(4-6-13)18-15(22)19-17-9-10-8-11(16)2-7-14(10)20/h2-9,20H,1H3,(H2,18,19,22)/b17-9- |
| InChIKey | SOEGXIGERJVPHG-MFOYZWKCSA-N |
| XLogP | 3.37 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|