C15H13Cl2N3OS — CID 40571329
1-(2,4-dichlorophenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]thiourea (PubChem CID 40571329) has the molecular formula C15H13Cl2N3OS and a molecular weight of 354.26 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 40571329 |
| Molecular Formula | C15H13Cl2N3OS |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(Z)-(4-methoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1ccc(/C=N\NC(=S)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2N3OS/c1-21-12-5-2-10(3-6-12)9-18-20-15(22)19-14-7-4-11(16)8-13(14)17/h2-9H,1H3,(H2,19,20,22)/b18-9- |
| InChIKey | SXWIGZITHFGALF-NVMNQCDNSA-N |
| XLogP | 4.32 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|