C12H9Cl2N3S2 — CID 6902290
1-(2,4-dichlorophenyl)-3-[(E)-thiophen-3-ylmethylideneamino]thiourea (PubChem CID 6902290) has the molecular formula C12H9Cl2N3S2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(E)-thiophen-3-ylmethylideneamino]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(E)-thiophen-3-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 6902290 |
| Molecular Formula | C12H9Cl2N3S2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 328.96 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(E)-thiophen-3-ylmethylideneamino]thiourea |
| SMILES | S=C(N/N=C/c1ccsc1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl2N3S2/c13-9-1-2-11(10(14)5-9)16-12(18)17-15-6-8-3-4-19-7-8/h1-7H,(H2,16,17,18)/b15-6+ |
| InChIKey | JRSMUPSBSZLTGK-GIDUJCDVSA-N |
| XLogP | 4.38 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|