C16H14BrCl2N3O2S — CID 6884747
1-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)thiourea (PubChem CID 6884747) has the molecular formula C16H14BrCl2N3O2S and a molecular weight of 463.18 g/mol. Its IUPAC name is 1-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)thiourea.
| Compound Name | 1-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)thiourea |
|---|---|
| PubChem CID | 6884747 |
| Molecular Formula | C16H14BrCl2N3O2S |
| Molecular Weight | 463.18 g/mol |
| Exact Mass | 460.94 |
| IUPAC Name | 1-[(E)-(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-3-(2,4-dichlorophenyl)thiourea |
| SMILES | COc1cc(OC)c(/C=N/NC(=S)Nc2ccc(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C16H14BrCl2N3O2S/c1-23-14-7-15(24-2)11(17)5-9(14)8-20-22-16(25)21-13-4-3-10(18)6-12(13)19/h3-8H,1-2H3,(H2,21,22,25)/b20-8+ |
| InChIKey | RBGICDSSYONQDB-DNTJNYDQSA-N |
| XLogP | 5.09 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.18 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|