C14H10Cl2FN3S — CID 5424582
1-(2,4-dichlorophenyl)-3-[(Z)-(4-fluorophenyl)methylideneamino]thiourea (PubChem CID 5424582) has the molecular formula C14H10Cl2FN3S and a molecular weight of 342.23 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(Z)-(4-fluorophenyl)methylideneamino]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(Z)-(4-fluorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 5424582 |
| Molecular Formula | C14H10Cl2FN3S |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(Z)-(4-fluorophenyl)methylideneamino]thiourea |
| SMILES | Fc1ccc(/C=N\NC(=S)Nc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C14H10Cl2FN3S/c15-10-3-6-13(12(16)7-10)19-14(21)20-18-8-9-1-4-11(17)5-2-9/h1-8H,(H2,19,20,21)/b18-8- |
| InChIKey | RVLXBSYISIMSQS-LSCVHKIXSA-N |
| XLogP | 4.45 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|