C13H10F2N4S — CID 27484864
1-(2,4-difluorophenyl)-3-[(Z)-pyridin-4-ylmethylideneamino]thiourea (PubChem CID 27484864) has the molecular formula C13H10F2N4S and a molecular weight of 292.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(Z)-pyridin-4-ylmethylideneamino]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(Z)-pyridin-4-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 27484864 |
| Molecular Formula | C13H10F2N4S |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(Z)-pyridin-4-ylmethylideneamino]thiourea |
| SMILES | Fc1ccc(NC(=S)N/N=C\c2ccncc2)c(F)c1 |
| InChI | InChI=1S/C13H10F2N4S/c14-10-1-2-12(11(15)7-10)18-13(20)19-17-8-9-3-5-16-6-4-9/h1-8H,(H2,18,19,20)/b17-8- |
| InChIKey | HTZDTFARDRGVMO-IUXPMGMMSA-N |
| XLogP | 2.68 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|