C15H10F5N3S — CID 17337728
1-(2,4-difluorophenyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea (PubChem CID 17337728) has the molecular formula C15H10F5N3S and a molecular weight of 359.32 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 17337728 |
| Molecular Formula | C15H10F5N3S |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]thiourea |
| SMILES | Fc1ccc(NC(=S)N/N=C/c2ccc(C(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C15H10F5N3S/c16-11-5-6-13(12(17)7-11)22-14(24)23-21-8-9-1-3-10(4-2-9)15(18,19)20/h1-8H,(H2,22,23,24)/b21-8+ |
| InChIKey | PEGGKLXQXAJFQO-ODCIPOBUSA-N |
| XLogP | 4.30 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|