About 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea (PubChem CID 2803769) has the molecular formula C18H15F6N3OS
and a molecular weight of 435.39 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea |
| PubChem CID | 2803769 |
| Molecular Formula | C18H15F6N3OS |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea |
| SMILES | CCOc1ccc(C=NNC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H15F6N3OS/c1-2-28-15-5-3-11(4-6-15)10-25-27-16(29)26-14-8-12(17(19,20)21)7-13(9-14)18(22,23)24/h3-10H,2H2,1H3,(H2,26,27,29) |
| InChIKey | MEKIPJCVSPLZFX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea?
The IUPAC name of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea (CID 2803769) is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea.
What is the SMILES notation for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea?
The canonical SMILES for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea is CCOc1ccc(C=NNC(=S)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1.
What is the InChIKey of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea?
The InChIKey is MEKIPJCVSPLZFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F6N3OS/c1-2-28-15-5-3-11(4-6-15)10-25-27-16(29)26-14-8-12(17(19,20)21)7-13(9-14)18(22,23)24/h3-10H,2H2,1H3,(H2,26,27,29).
What are the key properties of 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea?
1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea has a molecular weight of 435.39 g/mol, XLogP of 5.44, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,5-bis(trifluoromethyl)phenyl]-3-[(4-ethoxyphenyl)methylideneamino]thiourea is sourced from PubChem (CID 2803769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).