C23H21N3O3S — CID 5165136
[4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate (PubChem CID 5165136) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is [4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 5165136 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | [4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(C=NNC(=S)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O3S/c1-2-28-20-14-10-18(11-15-20)22(27)29-21-12-8-17(9-13-21)16-24-26-23(30)25-19-6-4-3-5-7-19/h3-16H,2H2,1H3,(H2,25,26,30) |
| InChIKey | OEPOOGPPFZCVBC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|