C21H16ClN3O2S — CID 1117179
[4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate (PubChem CID 1117179) has the molecular formula C21H16ClN3O2S and a molecular weight of 409.90 g/mol. Its IUPAC name is [4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 1117179 |
| Molecular Formula | C21H16ClN3O2S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | [4-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(Oc1ccc(C=NNC(=S)Nc2ccccc2)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C21H16ClN3O2S/c22-19-9-5-4-8-18(19)20(26)27-17-12-10-15(11-13-17)14-23-25-21(28)24-16-6-2-1-3-7-16/h1-14H,(H2,24,25,28) |
| InChIKey | NRGJWELMSUUSGD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|