About (4-methanehydrazonoylphenyl) 2-chlorobenzoate
(4-methanehydrazonoylphenyl) 2-chlorobenzoate (PubChem CID 168530478) has the molecular formula C14H11ClN2O2
and a molecular weight of 274.71 g/mol. Its IUPAC name is (4-methanehydrazonoylphenyl) 2-chlorobenzoate.
Molecular Properties
| Compound Name | (4-methanehydrazonoylphenyl) 2-chlorobenzoate |
| PubChem CID | 168530478 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (4-methanehydrazonoylphenyl) 2-chlorobenzoate |
| SMILES | NN=Cc1ccc(OC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C14H11ClN2O2/c15-13-4-2-1-3-12(13)14(18)19-11-7-5-10(6-8-11)9-17-16/h1-9H,16H2 |
| InChIKey | CJFSKBLYLLQGQV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methanehydrazonoylphenyl) 2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methanehydrazonoylphenyl) 2-chlorobenzoate?
The IUPAC name of (4-methanehydrazonoylphenyl) 2-chlorobenzoate (CID 168530478) is (4-methanehydrazonoylphenyl) 2-chlorobenzoate.
What is the SMILES notation for (4-methanehydrazonoylphenyl) 2-chlorobenzoate?
The canonical SMILES for (4-methanehydrazonoylphenyl) 2-chlorobenzoate is NN=Cc1ccc(OC(=O)c2ccccc2Cl)cc1.
What is the InChIKey of (4-methanehydrazonoylphenyl) 2-chlorobenzoate?
The InChIKey is CJFSKBLYLLQGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN2O2/c15-13-4-2-1-3-12(13)14(18)19-11-7-5-10(6-8-11)9-17-16/h1-9H,16H2.
What are the key properties of (4-methanehydrazonoylphenyl) 2-chlorobenzoate?
(4-methanehydrazonoylphenyl) 2-chlorobenzoate has a molecular weight of 274.71 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methanehydrazonoylphenyl) 2-chlorobenzoate is sourced from PubChem (CID 168530478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).