C22H15ClFN3O4 — CID 5186669
[4-[[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 5186669) has the molecular formula C22H15ClFN3O4 and a molecular weight of 439.83 g/mol. Its IUPAC name is [4-[[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 5186669 |
| Molecular Formula | C22H15ClFN3O4 |
| Molecular Weight | 439.83 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | [4-[[[2-(4-fluoroanilino)-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(NN=Cc1ccc(OC(=O)c2ccccc2Cl)cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H15ClFN3O4/c23-19-4-2-1-3-18(19)22(30)31-17-11-5-14(6-12-17)13-25-27-21(29)20(28)26-16-9-7-15(24)8-10-16/h1-13H,(H,26,28)(H,27,29) |
| InChIKey | MYDIDSNMVNPTAK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|