C23H20BrN3O3S — CID 3300833
[4-bromo-2-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate (PubChem CID 3300833) has the molecular formula C23H20BrN3O3S and a molecular weight of 498.40 g/mol. Its IUPAC name is [4-bromo-2-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate.
| Compound Name | [4-bromo-2-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 3300833 |
| Molecular Formula | C23H20BrN3O3S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | [4-bromo-2-[(phenylcarbamothioylhydrazinylidene)methyl]phenyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)Oc2ccc(Br)cc2C=NNC(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C23H20BrN3O3S/c1-2-29-20-11-8-16(9-12-20)22(28)30-21-13-10-18(24)14-17(21)15-25-27-23(31)26-19-6-4-3-5-7-19/h3-15H,2H2,1H3,(H2,26,27,31) |
| InChIKey | MMTPWRJJOBTSAU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|