C21H18FN3OS — CID 4200590
1-(4-fluorophenyl)-3-[(4-phenylmethoxyphenyl)methylideneamino]thiourea (PubChem CID 4200590) has the molecular formula C21H18FN3OS and a molecular weight of 379.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(4-phenylmethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[(4-phenylmethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4200590 |
| Molecular Formula | C21H18FN3OS |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(4-phenylmethoxyphenyl)methylideneamino]thiourea |
| SMILES | Fc1ccc(NC(=S)NN=Cc2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C21H18FN3OS/c22-18-8-10-19(11-9-18)24-21(27)25-23-14-16-6-12-20(13-7-16)26-15-17-4-2-1-3-5-17/h1-14H,15H2,(H2,24,25,27) |
| InChIKey | ZRSUDFVXPVFPDZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|