C21H17Cl2N3OS — CID 3375542
1-(3-chlorophenyl)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]thiourea (PubChem CID 3375542) has the molecular formula C21H17Cl2N3OS and a molecular weight of 430.36 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 3375542 |
| Molecular Formula | C21H17Cl2N3OS |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.05 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]thiourea |
| SMILES | S=C(NN=Cc1ccc(OCc2ccc(Cl)cc2)cc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17Cl2N3OS/c22-17-8-4-16(5-9-17)14-27-20-10-6-15(7-11-20)13-24-26-21(28)25-19-3-1-2-18(23)12-19/h1-13H,14H2,(H2,25,26,28) |
| InChIKey | VUMZXCIROYJTFK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|