C35H31N7O2S2 — CID 5471837
1-phenyl-3-[[4-[[6-[[4-[(phenylcarbamothioylhydrazinylidene)methyl]phenoxy]methyl]-2-pyridinyl]methoxy]phenyl]methylideneamino]thiourea (PubChem CID 5471837) has the molecular formula C35H31N7O2S2 and a molecular weight of 645.81 g/mol. Its IUPAC name is 1-phenyl-3-[[4-[[6-[[4-[(phenylcarbamothioylhydrazinylidene)methyl]phenoxy]methyl]-2-pyridinyl]methoxy]phenyl]methylideneamino]thiourea.
| Compound Name | 1-phenyl-3-[[4-[[6-[[4-[(phenylcarbamothioylhydrazinylidene)methyl]phenoxy]methyl]-2-pyridinyl]methoxy]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 5471837 |
| Molecular Formula | C35H31N7O2S2 |
| Molecular Weight | 645.81 g/mol |
| Exact Mass | 645.20 |
| IUPAC Name | 1-phenyl-3-[[4-[[6-[[4-[(phenylcarbamothioylhydrazinylidene)methyl]phenoxy]methyl]-2-pyridinyl]methoxy]phenyl]methylideneamino]thiourea |
| SMILES | S=C(NN=Cc1ccc(OCc2cccc(COc3ccc(C=NNC(=S)Nc4ccccc4)cc3)n2)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C35H31N7O2S2/c45-34(39-28-8-3-1-4-9-28)41-36-22-26-14-18-32(19-15-26)43-24-30-12-7-13-31(38-30)25-44-33-20-16-27(17-21-33)23-37-42-35(46)40-29-10-5-2-6-11-29/h1-23H,24-25H2,(H2,39,41,45)(H2,40,42,46) |
| InChIKey | OLUIJKSRYTXBSF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.81 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|