C14H9F5N2 — CID 134123873
2,5-difluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline (PubChem CID 134123873) has the molecular formula C14H9F5N2 and a molecular weight of 300.23 g/mol. Its IUPAC name is 2,5-difluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline.
| Compound Name | 2,5-difluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 134123873 |
| Molecular Formula | C14H9F5N2 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2,5-difluoro-N-[(E)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline |
| SMILES | Fc1ccc(F)c(N/N=C/c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C14H9F5N2/c15-11-5-6-12(16)13(7-11)21-20-8-9-1-3-10(4-2-9)14(17,18)19/h1-8,21H/b20-8+ |
| InChIKey | VZVWZBIFGRRBAK-DNTJNYDQSA-N |
| XLogP | 4.43 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|