C17H10F5N3S — CID 155542324
N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine (PubChem CID 155542324) has the molecular formula C17H10F5N3S and a molecular weight of 383.35 g/mol. Its IUPAC name is N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 155542324 |
| Molecular Formula | C17H10F5N3S |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(/C=N/Nc2nc(-c3ccc(C(F)(F)F)cc3)cs2)cc1F |
| InChI | InChI=1S/C17H10F5N3S/c18-13-6-1-10(7-14(13)19)8-23-25-16-24-15(9-26-16)11-2-4-12(5-3-11)17(20,21)22/h1-9H,(H,24,25)/b23-8+ |
| InChIKey | XDKIXIWBMYDGIV-LIMNOBDPSA-N |
| XLogP | 5.55 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|