C17H13F3N4S — CID 168625820
2-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168625820) has the molecular formula C17H13F3N4S and a molecular weight of 362.38 g/mol. Its IUPAC name is 2-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168625820 |
| Molecular Formula | C17H13F3N4S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 2-N-[[4-[4-(trifluoromethyl)phenyl]phenyl]methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C17H13F3N4S/c18-17(19,20)14-7-5-13(6-8-14)12-3-1-11(2-4-12)9-22-24-16-23-15(21)10-25-16/h1-10H,21H2,(H,23,24) |
| InChIKey | NRTZUHDXCBNNPW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|