C11H10N4O2S — CID 168625512
4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid (PubChem CID 168625512) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 168625512 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]benzoic acid |
| SMILES | Nc1csc(NN=Cc2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C11H10N4O2S/c12-9-6-18-11(14-9)15-13-5-7-1-3-8(4-2-7)10(16)17/h1-6H,12H2,(H,14,15)(H,16,17) |
| InChIKey | CNFFEQWDAQWKRZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|