C17H12N4O4S — CID 110337561
4-[(E)-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoic acid (PubChem CID 110337561) has the molecular formula C17H12N4O4S and a molecular weight of 368.37 g/mol. Its IUPAC name is 4-[(E)-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 110337561 |
| Molecular Formula | C17H12N4O4S |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 4-[(E)-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N/Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1 |
| InChI | InChI=1S/C17H12N4O4S/c22-16(23)12-6-4-11(5-7-12)9-18-20-17-19-15(10-26-17)13-2-1-3-14(8-13)21(24)25/h1-10H,(H,19,20)(H,22,23)/b18-9+ |
| InChIKey | OVBFFTOBIWCZMM-GIJQJNRQSA-N |
| XLogP | 3.86 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|