C14H10N4O3S — CID 110337035
N-[(E)-furan-2-ylmethylideneamino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine (PubChem CID 110337035) has the molecular formula C14H10N4O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is N-[(E)-furan-2-ylmethylideneamino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-furan-2-ylmethylideneamino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110337035 |
| Molecular Formula | C14H10N4O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | N-[(E)-furan-2-ylmethylideneamino]-4-(3-nitrophenyl)-1,3-thiazol-2-amine |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(N/N=C/c3ccco3)n2)c1 |
| InChI | InChI=1S/C14H10N4O3S/c19-18(20)11-4-1-3-10(7-11)13-9-22-14(16-13)17-15-8-12-5-2-6-21-12/h1-9H,(H,16,17)/b15-8+ |
| InChIKey | QQGPLQBKOFJXCU-OVCLIPMQSA-N |
| XLogP | 3.76 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_furan_A(6)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|