C14H11BrFN3OS — CID 18552758
4-(4-fluorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-1,3-thiazol-2-amine;hydrobromide (PubChem CID 18552758) has the molecular formula C14H11BrFN3OS and a molecular weight of 368.23 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-1,3-thiazol-2-amine;hydrobromide.
| Compound Name | 4-(4-fluorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-1,3-thiazol-2-amine;hydrobromide |
|---|---|
| PubChem CID | 18552758 |
| Molecular Formula | C14H11BrFN3OS |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[(E)-furan-2-ylmethylideneamino]-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Fc1ccc(-c2csc(N/N=C/c3ccco3)n2)cc1 |
| InChI | InChI=1S/C14H10FN3OS.BrH/c15-11-5-3-10(4-6-11)13-9-20-14(17-13)18-16-8-12-2-1-7-19-12;/h1-9H,(H,17,18);1H/b16-8+; |
| InChIKey | ZWIGCRWWFWIILI-OHGISNTKSA-N |
| XLogP | 4.57 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_furan_A(6)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|