C21H22N4O3S — CID 110338680
4-(3-nitrophenyl)-N-[(E)-(4-pentoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 110338680) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-N-[(E)-(4-pentoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(3-nitrophenyl)-N-[(E)-(4-pentoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 110338680 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-(3-nitrophenyl)-N-[(E)-(4-pentoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1ccc(/C=N/Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-2-3-4-12-28-19-10-8-16(9-11-19)14-22-24-21-23-20(15-29-21)17-6-5-7-18(13-17)25(26)27/h5-11,13-15H,2-4,12H2,1H3,(H,23,24)/b22-14+ |
| InChIKey | FTBMBYKSSCOHOF-HYARGMPZSA-N |
| XLogP | 5.73 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|