C12H12ClN5O2S — CID 168627035
2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-chlorophenoxy]acetamide (PubChem CID 168627035) has the molecular formula C12H12ClN5O2S and a molecular weight of 325.78 g/mol. Its IUPAC name is 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-chlorophenoxy]acetamide.
| Compound Name | 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-chlorophenoxy]acetamide |
|---|---|
| PubChem CID | 168627035 |
| Molecular Formula | C12H12ClN5O2S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 2-[4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-chlorophenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(C=NNc2nc(N)cs2)cc1Cl |
| InChI | InChI=1S/C12H12ClN5O2S/c13-8-3-7(1-2-9(8)20-5-11(15)19)4-16-18-12-17-10(14)6-21-12/h1-4,6H,5,14H2,(H2,15,19)(H,17,18) |
| InChIKey | RDGFSHLHFIOKAY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|