C10H9FN4OS — CID 168625668
4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-fluorophenol (PubChem CID 168625668) has the molecular formula C10H9FN4OS and a molecular weight of 252.27 g/mol. Its IUPAC name is 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-fluorophenol.
| Compound Name | 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-fluorophenol |
|---|---|
| PubChem CID | 168625668 |
| Molecular Formula | C10H9FN4OS |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-2-fluorophenol |
| SMILES | Nc1csc(NN=Cc2ccc(O)c(F)c2)n1 |
| InChI | InChI=1S/C10H9FN4OS/c11-7-3-6(1-2-8(7)16)4-13-15-10-14-9(12)5-17-10/h1-5,16H,12H2,(H,14,15) |
| InChIKey | HCXIEUQYWASTHN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|