C16H14N4OS — CID 168626387
3-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol (PubChem CID 168626387) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol.
| Compound Name | 3-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol |
|---|---|
| PubChem CID | 168626387 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-[3-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenyl]phenol |
| SMILES | Nc1csc(NN=Cc2cccc(-c3cccc(O)c3)c2)n1 |
| InChI | InChI=1S/C16H14N4OS/c17-15-10-22-16(19-15)20-18-9-11-3-1-4-12(7-11)13-5-2-6-14(21)8-13/h1-10,21H,17H2,(H,19,20) |
| InChIKey | RYFGZXTYPKQVKN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|