C19H15N5S — CID 168626742
2-N-[(2-phenylquinolin-7-yl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626742) has the molecular formula C19H15N5S and a molecular weight of 345.43 g/mol. Its IUPAC name is 2-N-[(2-phenylquinolin-7-yl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(2-phenylquinolin-7-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626742 |
| Molecular Formula | C19H15N5S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-N-[(2-phenylquinolin-7-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2ccc3ccc(-c4ccccc4)nc3c2)n1 |
| InChI | InChI=1S/C19H15N5S/c20-18-12-25-19(23-18)24-21-11-13-6-7-15-8-9-16(22-17(15)10-13)14-4-2-1-3-5-14/h1-12H,20H2,(H,23,24) |
| InChIKey | OGEVSADRBPZMAI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|