C19H17N5S — CID 168626932
2-N-[(1-benzylindol-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine (PubChem CID 168626932) has the molecular formula C19H17N5S and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-N-[(1-benzylindol-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine.
| Compound Name | 2-N-[(1-benzylindol-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
|---|---|
| PubChem CID | 168626932 |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-N-[(1-benzylindol-6-yl)methylideneamino]-1,3-thiazole-2,4-diamine |
| SMILES | Nc1csc(NN=Cc2ccc3ccn(Cc4ccccc4)c3c2)n1 |
| InChI | InChI=1S/C19H17N5S/c20-18-13-25-19(22-18)23-21-11-15-6-7-16-8-9-24(17(16)10-15)12-14-4-2-1-3-5-14/h1-11,13H,12,20H2,(H,22,23) |
| InChIKey | HGZBZCIGJIUMFT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|