C14H17N3OS — CID 3422737
3-[[(4-tert-butyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 3422737) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is 3-[[(4-tert-butyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 3-[[(4-tert-butyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 3422737 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-[[(4-tert-butyl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | CC(C)(C)c1csc(NN=Cc2cccc(O)c2)n1 |
| InChI | InChI=1S/C14H17N3OS/c1-14(2,3)12-9-19-13(16-12)17-15-8-10-5-4-6-11(18)7-10/h4-9,18H,1-3H3,(H,16,17) |
| InChIKey | REGKIQUFKNFTBY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|