C20H22N4O3S2 — CID 4701560
N,N-diethyl-3-[2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 4701560) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is N,N-diethyl-3-[2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-3-[2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4701560 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | N,N-diethyl-3-[2-[2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(-c2csc(NN=Cc3cccc(O)c3)n2)c1 |
| InChI | InChI=1S/C20H22N4O3S2/c1-3-24(4-2)29(26,27)18-10-6-8-16(12-18)19-14-28-20(22-19)23-21-13-15-7-5-9-17(25)11-15/h5-14,25H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | CQSVQZDUIUQHKC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|