C22H26N4O2S2 — CID 4701435
3-[2-(2-benzylidenehydrazinyl)-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide (PubChem CID 4701435) has the molecular formula C22H26N4O2S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 3-[2-(2-benzylidenehydrazinyl)-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide.
| Compound Name | 3-[2-(2-benzylidenehydrazinyl)-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide |
|---|---|
| PubChem CID | 4701435 |
| Molecular Formula | C22H26N4O2S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 3-[2-(2-benzylidenehydrazinyl)-1,3-thiazol-4-yl]-N,N-dipropylbenzenesulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1cccc(-c2csc(NN=Cc3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H26N4O2S2/c1-3-13-26(14-4-2)30(27,28)20-12-8-11-19(15-20)21-17-29-22(24-21)25-23-16-18-9-6-5-7-10-18/h5-12,15-17H,3-4,13-14H2,1-2H3,(H,24,25) |
| InChIKey | GGYGVKNUHYBGJK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|